C34H66N8O2Si — CID 173345571
ethane-1,2-diol;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;silane (PubChem CID 173345571) has the molecular formula C34H66N8O2Si and a molecular weight of 647.04 g/mol. Its IUPAC name is ethane-1,2-diol;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;silane.
| Compound Name | ethane-1,2-diol;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;silane |
|---|---|
| PubChem CID | 173345571 |
| Molecular Formula | C34H66N8O2Si |
| Molecular Weight | 647.04 g/mol |
| Exact Mass | 646.51 |
| IUPAC Name | ethane-1,2-diol;2,11,20,29,37,38,39,40-octazanonacyclo[28.6.1.13,10.112,19.121,28.04,9.013,18.022,27.031,36]tetracontane;silane |
| SMILES | C1CCC2C3NC(NC4NC(NC5NC(NC6NC(N3)C3CCCCC63)C3CCCCC53)C3CCCCC43)C2C1.OCCO.[SiH4] |
| InChI | InChI=1S/C32H56N8.C2H6O2.H4Si/c1-2-10-18-17(9-1)25-33-26(18)38-28-21-13-5-6-14-22(21)30(35-28)40-32-24-16-8-7-15-23(24)31(36-32)39-29-20-12-4-3-11-19(20)27(34-29)37-25;3-1-2-4;/h17-40H,1-16H2;3-4H,1-2H2;1H4 |
| InChIKey | XPCGZEVOUMKFQM-UHFFFAOYSA-N |
| XLogP | 0.12 |
| TPSA | 136.70 Ų |
| H-Bond Donors | 10 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.04 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 10 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|