About 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate
10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate (PubChem CID 173347428) has the molecular formula C20H43NO
and a molecular weight of 313.57 g/mol. Its IUPAC name is 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate.
Molecular Properties
| Compound Name | 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate |
| PubChem CID | 173347428 |
| Molecular Formula | C20H43NO |
| Molecular Weight | 313.57 g/mol |
| Exact Mass | 313.33 |
| IUPAC Name | 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate |
| SMILES | CCN(CC)CCCCCCCCCCC1CCCCC1.O |
| InChI | InChI=1S/C20H41N.H2O/c1-3-21(4-2)19-15-10-8-6-5-7-9-12-16-20-17-13-11-14-18-20;/h20H,3-19H2,1-2H3;1H2 |
| InChIKey | ZRPHZCATNZIKPT-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 34.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 313.57 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate?
The IUPAC name of 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate (CID 173347428) is 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate.
What is the SMILES notation for 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate?
The canonical SMILES for 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate is CCN(CC)CCCCCCCCCCC1CCCCC1.O.
What is the InChIKey of 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate?
The InChIKey is ZRPHZCATNZIKPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H41N.H2O/c1-3-21(4-2)19-15-10-8-6-5-7-9-12-16-20-17-13-11-14-18-20;/h20H,3-19H2,1-2H3;1H2.
What are the key properties of 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate?
10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate has a molecular weight of 313.57 g/mol, XLogP of 5.59, 13 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-cyclohexyl-N,N-diethyldecan-1-amine;hydrate is sourced from PubChem (CID 173347428), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).