About 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride
10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride (PubChem CID 173360948) has the molecular formula C22H46ClN
and a molecular weight of 360.07 g/mol. Its IUPAC name is 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride.
Molecular Properties
| Compound Name | 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride |
| PubChem CID | 173360948 |
| Molecular Formula | C22H46ClN |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 359.33 |
| IUPAC Name | 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride |
| SMILES | CCCN(CCC)CCCCCCCCCCC1CCCCC1.Cl |
| InChI | InChI=1S/C22H45N.ClH/c1-3-19-23(20-4-2)21-15-10-8-6-5-7-9-12-16-22-17-13-11-14-18-22;/h22H,3-21H2,1-2H3;1H |
| InChIKey | DGTZUTMTQAYAAF-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride?
The IUPAC name of 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride (CID 173360948) is 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride.
What is the SMILES notation for 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride?
The canonical SMILES for 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride is CCCN(CCC)CCCCCCCCCCC1CCCCC1.Cl.
What is the InChIKey of 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride?
The InChIKey is DGTZUTMTQAYAAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H45N.ClH/c1-3-19-23(20-4-2)21-15-10-8-6-5-7-9-12-16-22-17-13-11-14-18-22;/h22H,3-21H2,1-2H3;1H.
What are the key properties of 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride?
10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride has a molecular weight of 360.07 g/mol, XLogP of 7.62, 15 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 10-cyclohexyl-N,N-dipropyldecan-1-amine;hydrochloride is sourced from PubChem (CID 173360948), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).