C22H47NO — CID 173347592
1-(1,2-diethylcyclohexyl)dodecan-1-amine;hydrate (PubChem CID 173347592) has the molecular formula C22H47NO and a molecular weight of 341.62 g/mol. Its IUPAC name is 1-(1,2-diethylcyclohexyl)dodecan-1-amine;hydrate.
| Compound Name | 1-(1,2-diethylcyclohexyl)dodecan-1-amine;hydrate |
|---|---|
| PubChem CID | 173347592 |
| Molecular Formula | C22H47NO |
| Molecular Weight | 341.62 g/mol |
| Exact Mass | 341.37 |
| IUPAC Name | 1-(1,2-diethylcyclohexyl)dodecan-1-amine;hydrate |
| SMILES | CCCCCCCCCCCC(N)C1(CC)CCCCC1CC.O |
| InChI | InChI=1S/C22H45N.H2O/c1-4-7-8-9-10-11-12-13-14-18-21(23)22(6-3)19-16-15-17-20(22)5-2;/h20-21H,4-19,23H2,1-3H3;1H2 |
| InChIKey | ROJFSILZCGNUBE-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.62 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|