C20H42ClN — CID 173360909
1-(1,2-dipropylcyclohexyl)octan-1-amine;hydrochloride (PubChem CID 173360909) has the molecular formula C20H42ClN and a molecular weight of 332.02 g/mol. Its IUPAC name is 1-(1,2-dipropylcyclohexyl)octan-1-amine;hydrochloride.
| Compound Name | 1-(1,2-dipropylcyclohexyl)octan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 173360909 |
| Molecular Formula | C20H42ClN |
| Molecular Weight | 332.02 g/mol |
| Exact Mass | 331.30 |
| IUPAC Name | 1-(1,2-dipropylcyclohexyl)octan-1-amine;hydrochloride |
| SMILES | CCCCCCCC(N)C1(CCC)CCCCC1CCC.Cl |
| InChI | InChI=1S/C20H41N.ClH/c1-4-7-8-9-10-15-19(21)20(16-6-3)17-12-11-14-18(20)13-5-2;/h18-19H,4-17,21H2,1-3H3;1H |
| InChIKey | MITBJTRYGUGXOF-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.02 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|