About [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea
[N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea (PubChem CID 173348473) has the molecular formula C11H16N4OS
and a molecular weight of 252.34 g/mol. Its IUPAC name is [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea.
Molecular Properties
| Compound Name | [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea |
| PubChem CID | 173348473 |
| Molecular Formula | C11H16N4OS |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea |
| SMILES | COC(Cc1ccccc1)N=C(N)NC(N)=S |
| InChI | InChI=1S/C11H16N4OS/c1-16-9(14-10(12)15-11(13)17)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H5,12,13,14,15,17) |
| InChIKey | PQCIWFPZALREBR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 85.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea?
The IUPAC name of [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea (CID 173348473) is [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea.
What is the SMILES notation for [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea?
The canonical SMILES for [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea is COC(Cc1ccccc1)N=C(N)NC(N)=S.
What is the InChIKey of [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea?
The InChIKey is PQCIWFPZALREBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N4OS/c1-16-9(14-10(12)15-11(13)17)7-8-5-3-2-4-6-8/h2-6,9H,7H2,1H3,(H5,12,13,14,15,17).
What are the key properties of [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea?
[N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea has a molecular weight of 252.34 g/mol, XLogP of 0.35, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [N'-(1-methoxy-2-phenylethyl)carbamimidoyl]thiourea is sourced from PubChem (CID 173348473), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).