6-imino-2-phenylhexa-2,5-dienoic acid

C12H11NO2 — CID 173348694

IUPAC6-imino-2-phenylhexa-2,5-dienoic acid
SMILESN=C=CCC=C(C(=O)O)c1ccccc1
InChIInChI=1S/C12H11NO2/c13-9-5-4-8-11(12(14)15)10-6-2-1-3-7-10/h1-3,5-8,13H,4H2,(H,14,15)
InChIKeyPJTILENUHPVWIX-UHFFFAOYSA-N
MW201.22 g/mol
LogP2.35
Rot. Bonds4

About 6-imino-2-phenylhexa-2,5-dienoic acid

6-imino-2-phenylhexa-2,5-dienoic acid (PubChem CID 173348694) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 6-imino-2-phenylhexa-2,5-dienoic acid.

Molecular Properties

Compound Name6-imino-2-phenylhexa-2,5-dienoic acid
PubChem CID173348694
Molecular FormulaC12H11NO2
Molecular Weight201.22 g/mol
Exact Mass201.08
IUPAC Name6-imino-2-phenylhexa-2,5-dienoic acid
SMILESN=C=CCC=C(C(=O)O)c1ccccc1
InChIInChI=1S/C12H11NO2/c13-9-5-4-8-11(12(14)15)10-6-2-1-3-7-10/h1-3,5-8,13H,4H2,(H,14,15)
InChIKeyPJTILENUHPVWIX-UHFFFAOYSA-N
XLogP2.35
TPSA61.15 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms15
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500201.22
LogP ≤ 52.35
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze 6-imino-2-phenylhexa-2,5-dienoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6-imino-2-phenylhexa-2,5-dienoic acid?
The IUPAC name of 6-imino-2-phenylhexa-2,5-dienoic acid (CID 173348694) is 6-imino-2-phenylhexa-2,5-dienoic acid.
What is the SMILES notation for 6-imino-2-phenylhexa-2,5-dienoic acid?
The canonical SMILES for 6-imino-2-phenylhexa-2,5-dienoic acid is N=C=CCC=C(C(=O)O)c1ccccc1.
What is the InChIKey of 6-imino-2-phenylhexa-2,5-dienoic acid?
The InChIKey is PJTILENUHPVWIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO2/c13-9-5-4-8-11(12(14)15)10-6-2-1-3-7-10/h1-3,5-8,13H,4H2,(H,14,15).
What are the key properties of 6-imino-2-phenylhexa-2,5-dienoic acid?
6-imino-2-phenylhexa-2,5-dienoic acid has a molecular weight of 201.22 g/mol, XLogP of 2.35, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-imino-2-phenylhexa-2,5-dienoic acid is sourced from PubChem (CID 173348694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).