C12H11NO2 — CID 173348694
6-imino-2-phenylhexa-2,5-dienoic acid (PubChem CID 173348694) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 6-imino-2-phenylhexa-2,5-dienoic acid.
| Compound Name | 6-imino-2-phenylhexa-2,5-dienoic acid |
|---|---|
| PubChem CID | 173348694 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 6-imino-2-phenylhexa-2,5-dienoic acid |
| SMILES | N=C=CCC=C(C(=O)O)c1ccccc1 |
| InChI | InChI=1S/C12H11NO2/c13-9-5-4-8-11(12(14)15)10-6-2-1-3-7-10/h1-3,5-8,13H,4H2,(H,14,15) |
| InChIKey | PJTILENUHPVWIX-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 61.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|