C17H18O3 — CID 173351114
[4-(1-cyclohexa-2,4-dien-1-ylidene-2-methylpropyl)phenyl] hydrogen carbonate (PubChem CID 173351114) has the molecular formula C17H18O3 and a molecular weight of 270.33 g/mol. Its IUPAC name is [4-(1-cyclohexa-2,4-dien-1-ylidene-2-methylpropyl)phenyl] hydrogen carbonate.
| Compound Name | [4-(1-cyclohexa-2,4-dien-1-ylidene-2-methylpropyl)phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 173351114 |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.13 |
| IUPAC Name | [4-(1-cyclohexa-2,4-dien-1-ylidene-2-methylpropyl)phenyl] hydrogen carbonate |
| SMILES | CC(C)C(=C1C=CC=CC1)c1ccc(OC(=O)O)cc1 |
| InChI | InChI=1S/C17H18O3/c1-12(2)16(13-6-4-3-5-7-13)14-8-10-15(11-9-14)20-17(18)19/h3-6,8-12H,7H2,1-2H3,(H,18,19) |
| InChIKey | RPSDTPGZRRRNAH-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|