C23H26O4 — CID 173424207
4-[4-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenoxy]carbonylcyclohexane-1-carboxylic acid (PubChem CID 173424207) has the molecular formula C23H26O4 and a molecular weight of 366.46 g/mol. Its IUPAC name is 4-[4-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenoxy]carbonylcyclohexane-1-carboxylic acid.
| Compound Name | 4-[4-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenoxy]carbonylcyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 173424207 |
| Molecular Formula | C23H26O4 |
| Molecular Weight | 366.46 g/mol |
| Exact Mass | 366.18 |
| IUPAC Name | 4-[4-(2-cyclohexa-2,4-dien-1-ylidenepropyl)phenoxy]carbonylcyclohexane-1-carboxylic acid |
| SMILES | CC(Cc1ccc(OC(=O)C2CCC(C(=O)O)CC2)cc1)=C1C=CC=CC1 |
| InChI | InChI=1S/C23H26O4/c1-16(18-5-3-2-4-6-18)15-17-7-13-21(14-8-17)27-23(26)20-11-9-19(10-12-20)22(24)25/h2-5,7-8,13-14,19-20H,6,9-12,15H2,1H3,(H,24,25) |
| InChIKey | GOSBXYQUGJJBLM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.46 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|