C23H18BrNO3 — CID 17335195
N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-methoxynaphthalene-2-carboxamide (PubChem CID 17335195) has the molecular formula C23H18BrNO3 and a molecular weight of 436.31 g/mol. Its IUPAC name is N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-methoxynaphthalene-2-carboxamide.
| Compound Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-methoxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 17335195 |
| Molecular Formula | C23H18BrNO3 |
| Molecular Weight | 436.31 g/mol |
| Exact Mass | 435.05 |
| IUPAC Name | N-[[5-(4-bromophenyl)furan-2-yl]methyl]-3-methoxynaphthalene-2-carboxamide |
| SMILES | COc1cc2ccccc2cc1C(=O)NCc1ccc(-c2ccc(Br)cc2)o1 |
| InChI | InChI=1S/C23H18BrNO3/c1-27-22-13-17-5-3-2-4-16(17)12-20(22)23(26)25-14-19-10-11-21(28-19)15-6-8-18(24)9-7-15/h2-13H,14H2,1H3,(H,25,26) |
| InChIKey | PAXIZHSKRHRDCH-UHFFFAOYSA-N |
| XLogP | 5.80 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.31 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |