C15H12O2S2 — CID 173353316
6-(thiophen-3-ylmethylsulfanyl)naphthalene-2,3-diol (PubChem CID 173353316) has the molecular formula C15H12O2S2 and a molecular weight of 288.39 g/mol. Its IUPAC name is 6-(thiophen-3-ylmethylsulfanyl)naphthalene-2,3-diol.
| Compound Name | 6-(thiophen-3-ylmethylsulfanyl)naphthalene-2,3-diol |
|---|---|
| PubChem CID | 173353316 |
| Molecular Formula | C15H12O2S2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.03 |
| IUPAC Name | 6-(thiophen-3-ylmethylsulfanyl)naphthalene-2,3-diol |
| SMILES | Oc1cc2ccc(SCc3ccsc3)cc2cc1O |
| InChI | InChI=1S/C15H12O2S2/c16-14-6-11-1-2-13(5-12(11)7-15(14)17)19-9-10-3-4-18-8-10/h1-8,16-17H,9H2 |
| InChIKey | QSAPHQKVZCWALN-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|