C15H24BrMgN3O3+2 — CID 173354217
magnesium;5-amino-8-(5-methyl-2-nitroanilino)oct-1-en-4-ol;hydrobromide (PubChem CID 173354217) has the molecular formula C15H24BrMgN3O3+2 and a molecular weight of 398.58 g/mol. Its IUPAC name is magnesium;5-amino-8-(5-methyl-2-nitroanilino)oct-1-en-4-ol;hydrobromide.
| Compound Name | magnesium;5-amino-8-(5-methyl-2-nitroanilino)oct-1-en-4-ol;hydrobromide |
|---|---|
| PubChem CID | 173354217 |
| Molecular Formula | C15H24BrMgN3O3+2 |
| Molecular Weight | 398.58 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | magnesium;5-amino-8-(5-methyl-2-nitroanilino)oct-1-en-4-ol;hydrobromide |
| SMILES | Br.C=CCC(O)C(N)CCCNc1cc(C)ccc1[N+](=O)[O-].[Mg+2] |
| InChI | InChI=1S/C15H23N3O3.BrH.Mg/c1-3-5-15(19)12(16)6-4-9-17-13-10-11(2)7-8-14(13)18(20)21;;/h3,7-8,10,12,15,17,19H,1,4-6,9,16H2,2H3;1H;/q;;+2 |
| InChIKey | GYFOPBGETYPAHD-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 101.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.58 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|