C19H27N3O5 — CID 18656156
(2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitroanilino)pentanoic acid (PubChem CID 18656156) has the molecular formula C19H27N3O5 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitroanilino)pentanoic acid.
| Compound Name | (2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitroanilino)pentanoic acid |
|---|---|
| PubChem CID | 18656156 |
| Molecular Formula | C19H27N3O5 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | (2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitroanilino)pentanoic acid |
| SMILES | Cc1ccc([N+](=O)[O-])c(NCCC[C@@](N)(C(=O)O)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C19H27N3O5/c1-13-8-9-16(22(26)27)15(12-13)21-11-5-10-19(20,18(24)25)17(23)14-6-3-2-4-7-14/h8-9,12,14,21H,2-7,10-11,20H2,1H3,(H,24,25)/t19-/m0/s1 |
| InChIKey | YMKZAUBCHSRKSI-IBGZPJMESA-N |
| XLogP | 3.03 |
| TPSA | 135.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|