C19H26N2O6S — CID 18656147
(2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitrophenyl)sulfanyloxypentanoic acid (PubChem CID 18656147) has the molecular formula C19H26N2O6S and a molecular weight of 410.49 g/mol. Its IUPAC name is (2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitrophenyl)sulfanyloxypentanoic acid.
| Compound Name | (2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitrophenyl)sulfanyloxypentanoic acid |
|---|---|
| PubChem CID | 18656147 |
| Molecular Formula | C19H26N2O6S |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | (2S)-2-amino-2-(cyclohexanecarbonyl)-5-(5-methyl-2-nitrophenyl)sulfanyloxypentanoic acid |
| SMILES | Cc1ccc([N+](=O)[O-])c(SOCCC[C@@](N)(C(=O)O)C(=O)C2CCCCC2)c1 |
| InChI | InChI=1S/C19H26N2O6S/c1-13-8-9-15(21(25)26)16(12-13)28-27-11-5-10-19(20,18(23)24)17(22)14-6-3-2-4-7-14/h8-9,12,14H,2-7,10-11,20H2,1H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | BFKIACGCXUIFSE-IBGZPJMESA-N |
| XLogP | 3.64 |
| TPSA | 132.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|