C20H22N2O7S — CID 18656158
(2S)-5-(5-methyl-2-nitrophenyl)sulfanyloxy-2-(phenylmethoxycarbonylamino)pentanoic acid (PubChem CID 18656158) has the molecular formula C20H22N2O7S and a molecular weight of 434.47 g/mol. Its IUPAC name is (2S)-5-(5-methyl-2-nitrophenyl)sulfanyloxy-2-(phenylmethoxycarbonylamino)pentanoic acid.
| Compound Name | (2S)-5-(5-methyl-2-nitrophenyl)sulfanyloxy-2-(phenylmethoxycarbonylamino)pentanoic acid |
|---|---|
| PubChem CID | 18656158 |
| Molecular Formula | C20H22N2O7S |
| Molecular Weight | 434.47 g/mol |
| Exact Mass | 434.11 |
| IUPAC Name | (2S)-5-(5-methyl-2-nitrophenyl)sulfanyloxy-2-(phenylmethoxycarbonylamino)pentanoic acid |
| SMILES | Cc1ccc([N+](=O)[O-])c(SOCCC[C@H](NC(=O)OCc2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C20H22N2O7S/c1-14-9-10-17(22(26)27)18(12-14)30-29-11-5-8-16(19(23)24)21-20(25)28-13-15-6-3-2-4-7-15/h2-4,6-7,9-10,12,16H,5,8,11,13H2,1H3,(H,21,25)(H,23,24)/t16-/m0/s1 |
| InChIKey | ZKSSODILOUBFRA-INIZCTEOSA-N |
| XLogP | 4.09 |
| TPSA | 128.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.47 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|