About sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate
sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate (PubChem CID 173354968) has the molecular formula C28H45NaO3S
and a molecular weight of 484.72 g/mol. Its IUPAC name is sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate.
Molecular Properties
| Compound Name | sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate |
| PubChem CID | 173354968 |
| Molecular Formula | C28H45NaO3S |
| Molecular Weight | 484.72 g/mol |
| Exact Mass | 484.30 |
| IUPAC Name | sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate |
| SMILES | CCCCCCCCCOS(=O)(=O)c1c(CCCCCCCCC)ccc2ccccc12.[H-].[Na+] |
| InChI | InChI=1S/C28H44O3S.Na.H/c1-3-5-7-9-11-13-15-20-26-23-22-25-19-16-17-21-27(25)28(26)32(29,30)31-24-18-14-12-10-8-6-4-2;;/h16-17,19,21-23H,3-15,18,20,24H2,1-2H3;;/q;+1;-1 |
| InChIKey | BRALAXAEWXFROJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 484.72 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate?
The IUPAC name of sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate (CID 173354968) is sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate.
What is the SMILES notation for sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate?
The canonical SMILES for sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate is CCCCCCCCCOS(=O)(=O)c1c(CCCCCCCCC)ccc2ccccc12.[H-].[Na+].
What is the InChIKey of sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate?
The InChIKey is BRALAXAEWXFROJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H44O3S.Na.H/c1-3-5-7-9-11-13-15-20-26-23-22-25-19-16-17-21-27(25)28(26)32(29,30)31-24-18-14-12-10-8-6-4-2;;/h16-17,19,21-23H,3-15,18,20,24H2,1-2H3;;/q;+1;-1.
What are the key properties of sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate?
sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate has a molecular weight of 484.72 g/mol, XLogP of 5.71, 18 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;nonyl 2-nonylnaphthalene-1-sulfonate is sourced from PubChem (CID 173354968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).