C24H46O4Si2 — CID 173367844
[9-dimethylsilyloxy-10,10-dimethyl-1-(5-trimethylsilylfuran-3-yl)undecyl] acetate (PubChem CID 173367844) has the molecular formula C24H46O4Si2 and a molecular weight of 454.80 g/mol. Its IUPAC name is [9-dimethylsilyloxy-10,10-dimethyl-1-(5-trimethylsilylfuran-3-yl)undecyl] acetate.
| Compound Name | [9-dimethylsilyloxy-10,10-dimethyl-1-(5-trimethylsilylfuran-3-yl)undecyl] acetate |
|---|---|
| PubChem CID | 173367844 |
| Molecular Formula | C24H46O4Si2 |
| Molecular Weight | 454.80 g/mol |
| Exact Mass | 454.29 |
| IUPAC Name | [9-dimethylsilyloxy-10,10-dimethyl-1-(5-trimethylsilylfuran-3-yl)undecyl] acetate |
| SMILES | CC(=O)OC(CCCCCCCC(O[SiH](C)C)C(C)(C)C)c1coc([Si](C)(C)C)c1 |
| InChI | InChI=1S/C24H46O4Si2/c1-19(25)27-21(20-17-23(26-18-20)30(7,8)9)15-13-11-10-12-14-16-22(24(2,3)4)28-29(5)6/h17-18,21-22,29H,10-16H2,1-9H3 |
| InChIKey | FTYYAAOIISWUTG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 48.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.80 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|