About sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride
sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride (PubChem CID 173372057) has the molecular formula C18H17NaO4P+
and a molecular weight of 351.29 g/mol. Its IUPAC name is sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride.
Molecular Properties
| Compound Name | sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride |
| PubChem CID | 173372057 |
| Molecular Formula | C18H17NaO4P+ |
| Molecular Weight | 351.29 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride |
| SMILES | CCO[P+](=O)Oc1ccc(-c2ccc3ccccc3c2)cc1O.[H-].[Na+] |
| InChI | InChI=1S/C18H15O4P.Na.H/c1-2-21-23(20)22-18-10-9-16(12-17(18)19)15-8-7-13-5-3-4-6-14(13)11-15;;/h3-12H,2H2,1H3;;/q;+1;-1/p+1 |
| InChIKey | QGXZERLZIALCAD-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.29 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride?
The IUPAC name of sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride (CID 173372057) is sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride.
What is the SMILES notation for sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride?
The canonical SMILES for sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride is CCO[P+](=O)Oc1ccc(-c2ccc3ccccc3c2)cc1O.[H-].[Na+].
What is the InChIKey of sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride?
The InChIKey is QGXZERLZIALCAD-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H15O4P.Na.H/c1-2-21-23(20)22-18-10-9-16(12-17(18)19)15-8-7-13-5-3-4-6-14(13)11-15;;/h3-12H,2H2,1H3;;/q;+1;-1/p+1.
What are the key properties of sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride?
sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride has a molecular weight of 351.29 g/mol, XLogP of 2.40, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethoxy-(2-hydroxy-4-naphthalen-2-ylphenoxy)-oxophosphanium;hydride is sourced from PubChem (CID 173372057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).