C12H24O2Sn — CID 173373063
[butyl(diethyl)stannyl] 2-methylprop-2-enoate (PubChem CID 173373063) has the molecular formula C12H24O2Sn and a molecular weight of 319.03 g/mol. Its IUPAC name is [butyl(diethyl)stannyl] 2-methylprop-2-enoate.
| Compound Name | [butyl(diethyl)stannyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 173373063 |
| Molecular Formula | C12H24O2Sn |
| Molecular Weight | 319.03 g/mol |
| Exact Mass | 320.08 |
| IUPAC Name | [butyl(diethyl)stannyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)O[Sn](CC)(CC)CCCC |
| InChI | InChI=1S/C4H6O2.C4H9.2C2H5.Sn/c1-3(2)4(5)6;1-3-4-2;2*1-2;/h1H2,2H3,(H,5,6);1,3-4H2,2H3;2*1H2,2H3;/q;;;;+1/p-1 |
| InChIKey | ZGDZLFHJZBHIQP-UHFFFAOYSA-M |
| XLogP | 3.89 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.03 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|