C20H26 — CID 173380727
7-(2-methylpropyl)spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene] (PubChem CID 173380727) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is 7-(2-methylpropyl)spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene].
| Compound Name | 7-(2-methylpropyl)spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene] |
|---|---|
| PubChem CID | 173380727 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | 7-(2-methylpropyl)spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene] |
| SMILES | CC(C)Cc1ccc2c(c1)CCCC21CC2C=CC1C2 |
| InChI | InChI=1S/C20H26/c1-14(2)10-15-6-8-19-17(11-15)4-3-9-20(19)13-16-5-7-18(20)12-16/h5-8,11,14,16,18H,3-4,9-10,12-13H2,1-2H3 |
| InChIKey | MEPMKRVFKFZUQW-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|