C16H18 — CID 173049305
spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene] (PubChem CID 173049305) has the molecular formula C16H18 and a molecular weight of 210.32 g/mol. Its IUPAC name is spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene].
| Compound Name | spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene] |
|---|---|
| PubChem CID | 173049305 |
| Molecular Formula | C16H18 |
| Molecular Weight | 210.32 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | spiro[2,3-dihydro-1H-naphthalene-4,5'-bicyclo[2.2.1]hept-2-ene] |
| SMILES | C1=CC2CC1CC21CCCc2ccccc21 |
| InChI | InChI=1S/C16H18/c1-2-6-15-13(4-1)5-3-9-16(15)11-12-7-8-14(16)10-12/h1-2,4,6-8,12,14H,3,5,9-11H2 |
| InChIKey | VEQMEHICORJLMM-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.32 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|