About 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene
6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (PubChem CID 6663) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
Analyze 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene?
The IUPAC name of 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene (CID 6663) is 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene.
What is the SMILES notation for 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene?
The canonical SMILES for 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene is CCc1ccc2c(c1)C(C)(C)CCC2(C)C.
What is the InChIKey of 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene?
The InChIKey is SLIOAQVQWDNBNB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-6-12-7-8-13-14(11-12)16(4,5)10-9-15(13,2)3/h7-8,11H,6,9-10H2,1-5H3.
What are the key properties of 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene?
6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene has a molecular weight of 216.37 g/mol, XLogP of 4.60, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-ethyl-1,1,4,4-tetramethyl-2,3-dihydronaphthalene is sourced from PubChem (CID 6663), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).