C11H14 — CID 15262
1-methyl-1,2,3,4-tetrahydronaphthalene (PubChem CID 15262) has the molecular formula C11H14 and a molecular weight of 146.23 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-methyl-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 15262 |
| Molecular Formula | C11H14 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydronaphthalene |
| SMILES | CC1CCCc2ccccc21 |
| InChI | InChI=1S/C11H14/c1-9-5-4-7-10-6-2-3-8-11(9)10/h2-3,6,8-9H,4-5,7H2,1H3 |
| InChIKey | APBBTKKLSNPFDP-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |