C19H15IN4O2 — CID 173382990
4-(N'-hydroxycarbamimidoyl)-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide (PubChem CID 173382990) has the molecular formula C19H15IN4O2 and a molecular weight of 458.26 g/mol. Its IUPAC name is 4-(N'-hydroxycarbamimidoyl)-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide.
| Compound Name | 4-(N'-hydroxycarbamimidoyl)-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 173382990 |
| Molecular Formula | C19H15IN4O2 |
| Molecular Weight | 458.26 g/mol |
| Exact Mass | 458.02 |
| IUPAC Name | 4-(N'-hydroxycarbamimidoyl)-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide |
| SMILES | NC(=NO)c1ccc(C(=O)Nc2ccc(I)c(-c3ccccn3)c2)cc1 |
| InChI | InChI=1S/C19H15IN4O2/c20-16-9-8-14(11-15(16)17-3-1-2-10-22-17)23-19(25)13-6-4-12(5-7-13)18(21)24-26/h1-11,26H,(H2,21,24)(H,23,25) |
| InChIKey | KQOOXZUHHLZIKF-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.26 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|