C23H22IN3O4S — CID 70953951
4-(4-hydroxypiperidin-1-yl)sulfonyl-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide (PubChem CID 70953951) has the molecular formula C23H22IN3O4S and a molecular weight of 563.42 g/mol. Its IUPAC name is 4-(4-hydroxypiperidin-1-yl)sulfonyl-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide.
| Compound Name | 4-(4-hydroxypiperidin-1-yl)sulfonyl-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 70953951 |
| Molecular Formula | C23H22IN3O4S |
| Molecular Weight | 563.42 g/mol |
| Exact Mass | 563.04 |
| IUPAC Name | 4-(4-hydroxypiperidin-1-yl)sulfonyl-N-(4-iodo-3-pyridin-2-ylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(I)c(-c2ccccn2)c1)c1ccc(S(=O)(=O)N2CCC(O)CC2)cc1 |
| InChI | InChI=1S/C23H22IN3O4S/c24-21-9-6-17(15-20(21)22-3-1-2-12-25-22)26-23(29)16-4-7-19(8-5-16)32(30,31)27-13-10-18(28)11-14-27/h1-9,12,15,18,28H,10-11,13-14H2,(H,26,29) |
| InChIKey | XSGQUIOWMFOOGZ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.42 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|