C34H34Si — CID 173384771
[5-benzyl-4-(4-butylphenyl)cyclopenta-1,4-dien-1-yl]-diphenylsilane (PubChem CID 173384771) has the molecular formula C34H34Si and a molecular weight of 470.73 g/mol. Its IUPAC name is [5-benzyl-4-(4-butylphenyl)cyclopenta-1,4-dien-1-yl]-diphenylsilane.
| Compound Name | [5-benzyl-4-(4-butylphenyl)cyclopenta-1,4-dien-1-yl]-diphenylsilane |
|---|---|
| PubChem CID | 173384771 |
| Molecular Formula | C34H34Si |
| Molecular Weight | 470.73 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [5-benzyl-4-(4-butylphenyl)cyclopenta-1,4-dien-1-yl]-diphenylsilane |
| SMILES | CCCCc1ccc(C2=C(Cc3ccccc3)C([SiH](c3ccccc3)c3ccccc3)=CC2)cc1 |
| InChI | InChI=1S/C34H34Si/c1-2-3-13-27-20-22-29(23-21-27)32-24-25-34(33(32)26-28-14-7-4-8-15-28)35(30-16-9-5-10-17-30)31-18-11-6-12-19-31/h4-12,14-23,25,35H,2-3,13,24,26H2,1H3 |
| InChIKey | RYZNXNRXFGMBGS-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.73 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|