C20H25NO — CID 173386567
N,N-dimethyl-2-[4-(4-phenylbut-1-enyl)phenoxy]ethanamine (PubChem CID 173386567) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-(4-phenylbut-1-enyl)phenoxy]ethanamine.
| Compound Name | N,N-dimethyl-2-[4-(4-phenylbut-1-enyl)phenoxy]ethanamine |
|---|---|
| PubChem CID | 173386567 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | N,N-dimethyl-2-[4-(4-phenylbut-1-enyl)phenoxy]ethanamine |
| SMILES | CN(C)CCOc1ccc(C=CCCc2ccccc2)cc1 |
| InChI | InChI=1S/C20H25NO/c1-21(2)16-17-22-20-14-12-19(13-15-20)11-7-6-10-18-8-4-3-5-9-18/h3-5,7-9,11-15H,6,10,16-17H2,1-2H3 |
| InChIKey | ZTUXIZOAGGDUCK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |