C13H18ClNO — CID 79334607
2-[4-(3-chloroprop-1-enyl)phenoxy]-N,N-dimethylethanamine (PubChem CID 79334607) has the molecular formula C13H18ClNO and a molecular weight of 239.75 g/mol. Its IUPAC name is 2-[4-(3-chloroprop-1-enyl)phenoxy]-N,N-dimethylethanamine.
| Compound Name | 2-[4-(3-chloroprop-1-enyl)phenoxy]-N,N-dimethylethanamine |
|---|---|
| PubChem CID | 79334607 |
| Molecular Formula | C13H18ClNO |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | 2-[4-(3-chloroprop-1-enyl)phenoxy]-N,N-dimethylethanamine |
| SMILES | CN(C)CCOc1ccc(C=CCCl)cc1 |
| InChI | InChI=1S/C13H18ClNO/c1-15(2)10-11-16-13-7-5-12(6-8-13)4-3-9-14/h3-8H,9-11H2,1-2H3 |
| InChIKey | XUZRDTRKEIICDR-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|