About potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate
potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate (PubChem CID 173390859) has the molecular formula C12H19KO7
and a molecular weight of 314.38 g/mol. Its IUPAC name is potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate.
Molecular Properties
| Compound Name | potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate |
| PubChem CID | 173390859 |
| Molecular Formula | C12H19KO7 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate |
| SMILES | C=CCC(O)(CO)C(=O)OC(=O)C(O)(CO)CC=C.[H-].[K+] |
| InChI | InChI=1S/C12H18O7.K.H/c1-3-5-11(17,7-13)9(15)19-10(16)12(18,8-14)6-4-2;;/h3-4,13-14,17-18H,1-2,5-8H2;;/q;+1;-1 |
| InChIKey | XBJYJVTUERYWAB-UHFFFAOYSA-N |
| XLogP | -4.23 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | -4.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate?
The IUPAC name of potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate (CID 173390859) is potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate.
What is the SMILES notation for potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate?
The canonical SMILES for potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate is C=CCC(O)(CO)C(=O)OC(=O)C(O)(CO)CC=C.[H-].[K+].
What is the InChIKey of potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate?
The InChIKey is XBJYJVTUERYWAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O7.K.H/c1-3-5-11(17,7-13)9(15)19-10(16)12(18,8-14)6-4-2;;/h3-4,13-14,17-18H,1-2,5-8H2;;/q;+1;-1.
What are the key properties of potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate?
potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate has a molecular weight of 314.38 g/mol, XLogP of -4.23, 8 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;hydride;[2-hydroxy-2-(hydroxymethyl)pent-4-enoyl] 2-hydroxy-2-(hydroxymethyl)pent-4-enoate is sourced from PubChem (CID 173390859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).