C31H60FNO3 — CID 173393402
11-amino-11-decanoylhenicosane-10,12-dione;hydrofluoride (PubChem CID 173393402) has the molecular formula C31H60FNO3 and a molecular weight of 513.82 g/mol. Its IUPAC name is 11-amino-11-decanoylhenicosane-10,12-dione;hydrofluoride.
| Compound Name | 11-amino-11-decanoylhenicosane-10,12-dione;hydrofluoride |
|---|---|
| PubChem CID | 173393402 |
| Molecular Formula | C31H60FNO3 |
| Molecular Weight | 513.82 g/mol |
| Exact Mass | 513.46 |
| IUPAC Name | 11-amino-11-decanoylhenicosane-10,12-dione;hydrofluoride |
| SMILES | CCCCCCCCCC(=O)C(N)(C(=O)CCCCCCCCC)C(=O)CCCCCCCCC.F |
| InChI | InChI=1S/C31H59NO3.FH/c1-4-7-10-13-16-19-22-25-28(33)31(32,29(34)26-23-20-17-14-11-8-5-2)30(35)27-24-21-18-15-12-9-6-3;/h4-27,32H2,1-3H3;1H |
| InChIKey | FPEXXXLBHACZED-UHFFFAOYSA-N |
| XLogP | 8.97 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.82 |
| LogP ≤ 5 | 8.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|