C49H75BrNO3P — CID 174886563
11-amino-11-decanoylhenicosane-10,12-dione;triphenylphosphane;hydrobromide (PubChem CID 174886563) has the molecular formula C49H75BrNO3P and a molecular weight of 837.02 g/mol. Its IUPAC name is 11-amino-11-decanoylhenicosane-10,12-dione;triphenylphosphane;hydrobromide.
| Compound Name | 11-amino-11-decanoylhenicosane-10,12-dione;triphenylphosphane;hydrobromide |
|---|---|
| PubChem CID | 174886563 |
| Molecular Formula | C49H75BrNO3P |
| Molecular Weight | 837.02 g/mol |
| Exact Mass | 835.47 |
| IUPAC Name | 11-amino-11-decanoylhenicosane-10,12-dione;triphenylphosphane;hydrobromide |
| SMILES | Br.CCCCCCCCCC(=O)C(N)(C(=O)CCCCCCCCC)C(=O)CCCCCCCCC.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C31H59NO3.C18H15P.BrH/c1-4-7-10-13-16-19-22-25-28(33)31(32,29(34)26-23-20-17-14-11-8-5-2)30(35)27-24-21-18-15-12-9-6-3;1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;/h4-27,32H2,1-3H3;1-15H;1H |
| InChIKey | QRZQWJCBOIPHHI-UHFFFAOYSA-N |
| XLogP | 12.84 |
| TPSA | 77.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 837.02 |
| LogP ≤ 5 | 12.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|