About acetic acid;N-methyloctan-1-amine;triphenylphosphane
acetic acid;N-methyloctan-1-amine;triphenylphosphane (PubChem CID 174886544) has the molecular formula C29H40NO2P
and a molecular weight of 465.62 g/mol. Its IUPAC name is acetic acid;N-methyloctan-1-amine;triphenylphosphane.
Molecular Properties
| Compound Name | acetic acid;N-methyloctan-1-amine;triphenylphosphane |
| PubChem CID | 174886544 |
| Molecular Formula | C29H40NO2P |
| Molecular Weight | 465.62 g/mol |
| Exact Mass | 465.28 |
| IUPAC Name | acetic acid;N-methyloctan-1-amine;triphenylphosphane |
| SMILES | CC(=O)O.CCCCCCCCNC.c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P.C9H21N.C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-4-5-6-7-8-9-10-2;1-2(3)4/h1-15H;10H,3-9H2,1-2H3;1H3,(H,3,4) |
| InChIKey | IKFNLZQFSJWYOX-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 465.62 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;N-methyloctan-1-amine;triphenylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;N-methyloctan-1-amine;triphenylphosphane?
The IUPAC name of acetic acid;N-methyloctan-1-amine;triphenylphosphane (CID 174886544) is acetic acid;N-methyloctan-1-amine;triphenylphosphane.
What is the SMILES notation for acetic acid;N-methyloctan-1-amine;triphenylphosphane?
The canonical SMILES for acetic acid;N-methyloctan-1-amine;triphenylphosphane is CC(=O)O.CCCCCCCCNC.c1ccc(P(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of acetic acid;N-methyloctan-1-amine;triphenylphosphane?
The InChIKey is IKFNLZQFSJWYOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H15P.C9H21N.C2H4O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;1-3-4-5-6-7-8-9-10-2;1-2(3)4/h1-15H;10H,3-9H2,1-2H3;1H3,(H,3,4).
What are the key properties of acetic acid;N-methyloctan-1-amine;triphenylphosphane?
acetic acid;N-methyloctan-1-amine;triphenylphosphane has a molecular weight of 465.62 g/mol, XLogP of 6.10, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;N-methyloctan-1-amine;triphenylphosphane is sourced from PubChem (CID 174886544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).