C32H42N4O6 — CID 173395051
butanedioic acid;bis(2-(3-methyl-2H-imidazol-1-yl)-1-(4-methylphenyl)propan-1-one) (PubChem CID 173395051) has the molecular formula C32H42N4O6 and a molecular weight of 578.71 g/mol. Its IUPAC name is butanedioic acid;bis(2-(3-methyl-2H-imidazol-1-yl)-1-(4-methylphenyl)propan-1-one).
| Compound Name | butanedioic acid;bis(2-(3-methyl-2H-imidazol-1-yl)-1-(4-methylphenyl)propan-1-one) |
|---|---|
| PubChem CID | 173395051 |
| Molecular Formula | C32H42N4O6 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | butanedioic acid;bis(2-(3-methyl-2H-imidazol-1-yl)-1-(4-methylphenyl)propan-1-one) |
| SMILES | Cc1ccc(C(=O)C(C)N2C=CN(C)C2)cc1.Cc1ccc(C(=O)C(C)N2C=CN(C)C2)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/2C14H18N2O.C4H6O4/c2*1-11-4-6-13(7-5-11)14(17)12(2)16-9-8-15(3)10-16;5-3(6)1-2-4(7)8/h2*4-9,12H,10H2,1-3H3;1-2H2,(H,5,6)(H,7,8) |
| InChIKey | OHMHUJKPQWMNHV-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 121.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |