C14H19NO3 — CID 82100127
4-[[1-(4-methylphenyl)-1-oxopropan-2-yl]amino]butanoic acid (PubChem CID 82100127) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is 4-[[1-(4-methylphenyl)-1-oxopropan-2-yl]amino]butanoic acid.
| Compound Name | 4-[[1-(4-methylphenyl)-1-oxopropan-2-yl]amino]butanoic acid |
|---|---|
| PubChem CID | 82100127 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 4-[[1-(4-methylphenyl)-1-oxopropan-2-yl]amino]butanoic acid |
| SMILES | Cc1ccc(C(=O)C(C)NCCCC(=O)O)cc1 |
| InChI | InChI=1S/C14H19NO3/c1-10-5-7-12(8-6-10)14(18)11(2)15-9-3-4-13(16)17/h5-8,11,15H,3-4,9H2,1-2H3,(H,16,17) |
| InChIKey | HXNJYSVRRZNTEE-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|