C8H21N4O3Sn- — CID 173397231
2-amino-2-(hydroxymethyl)propane-1,3-diol;butyl-λ2-stannane;azide (PubChem CID 173397231) has the molecular formula C8H21N4O3Sn- and a molecular weight of 339.99 g/mol. Its IUPAC name is 2-amino-2-(hydroxymethyl)propane-1,3-diol;butyl-λ2-stannane;azide.
| Compound Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;butyl-λ2-stannane;azide |
|---|---|
| PubChem CID | 173397231 |
| Molecular Formula | C8H21N4O3Sn- |
| Molecular Weight | 339.99 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-amino-2-(hydroxymethyl)propane-1,3-diol;butyl-λ2-stannane;azide |
| SMILES | CCCC[SnH].NC(CO)(CO)CO.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C4H11NO3.C4H9.N3.Sn.H/c5-4(1-6,2-7)3-8;1-3-4-2;1-3-2;;/h6-8H,1-3,5H2;1,3-4H2,2H3;;;/q;;-1;; |
| InChIKey | LRAJDYADHPRYIY-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 145.41 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.99 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|