About ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate
ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate (PubChem CID 173397580) has the molecular formula C9H12ClNO5
and a molecular weight of 249.65 g/mol. Its IUPAC name is ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate.
Molecular Properties
| Compound Name | ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate |
| PubChem CID | 173397580 |
| Molecular Formula | C9H12ClNO5 |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate |
| SMILES | CCOC(=O)CCC=NOCC(=O)C(=O)Cl |
| InChI | InChI=1S/C9H12ClNO5/c1-2-15-8(13)4-3-5-11-16-6-7(12)9(10)14/h5H,2-4,6H2,1H3 |
| InChIKey | ISHQHMZRXHDTOE-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 82.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate?
The IUPAC name of ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate (CID 173397580) is ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate.
What is the SMILES notation for ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate?
The canonical SMILES for ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate is CCOC(=O)CCC=NOCC(=O)C(=O)Cl.
What is the InChIKey of ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate?
The InChIKey is ISHQHMZRXHDTOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12ClNO5/c1-2-15-8(13)4-3-5-11-16-6-7(12)9(10)14/h5H,2-4,6H2,1H3.
What are the key properties of ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate?
ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate has a molecular weight of 249.65 g/mol, XLogP of 0.67, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(3-chloro-2,3-dioxopropoxy)iminobutanoate is sourced from PubChem (CID 173397580), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).