C19H24O6 — CID 173398155
5-[4-[3-(2-methylphenyl)prop-2-enoyloxy]butoxy]-5-oxopentanoic acid (PubChem CID 173398155) has the molecular formula C19H24O6 and a molecular weight of 348.39 g/mol. Its IUPAC name is 5-[4-[3-(2-methylphenyl)prop-2-enoyloxy]butoxy]-5-oxopentanoic acid.
| Compound Name | 5-[4-[3-(2-methylphenyl)prop-2-enoyloxy]butoxy]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 173398155 |
| Molecular Formula | C19H24O6 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 5-[4-[3-(2-methylphenyl)prop-2-enoyloxy]butoxy]-5-oxopentanoic acid |
| SMILES | Cc1ccccc1C=CC(=O)OCCCCOC(=O)CCCC(=O)O |
| InChI | InChI=1S/C19H24O6/c1-15-7-2-3-8-16(15)11-12-19(23)25-14-5-4-13-24-18(22)10-6-9-17(20)21/h2-3,7-8,11-12H,4-6,9-10,13-14H2,1H3,(H,20,21) |
| InChIKey | UMIYGJNCZCRGRF-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|