C15H26CaO6 — CID 174879871
calcium;7-(4-but-2-enoyloxybutoxy)-7-oxoheptanoic acid;hydride (PubChem CID 174879871) has the molecular formula C15H26CaO6 and a molecular weight of 342.44 g/mol. Its IUPAC name is calcium;7-(4-but-2-enoyloxybutoxy)-7-oxoheptanoic acid;hydride.
| Compound Name | calcium;7-(4-but-2-enoyloxybutoxy)-7-oxoheptanoic acid;hydride |
|---|---|
| PubChem CID | 174879871 |
| Molecular Formula | C15H26CaO6 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.14 |
| IUPAC Name | calcium;7-(4-but-2-enoyloxybutoxy)-7-oxoheptanoic acid;hydride |
| SMILES | CC=CC(=O)OCCCCOC(=O)CCCCCC(=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C15H24O6.Ca.2H/c1-2-8-14(18)20-11-6-7-12-21-15(19)10-5-3-4-9-13(16)17;;;/h2,8H,3-7,9-12H2,1H3,(H,16,17);;;/q;+2;2*-1 |
| InChIKey | SQOVRSNPEYKYLU-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|