C12H32O4Si3 — CID 173399866
2-[3-(oxadisilinan-3-yl)propoxy]ethanol;trimethylsilylmethanol (PubChem CID 173399866) has the molecular formula C12H32O4Si3 and a molecular weight of 324.64 g/mol. Its IUPAC name is 2-[3-(oxadisilinan-3-yl)propoxy]ethanol;trimethylsilylmethanol.
| Compound Name | 2-[3-(oxadisilinan-3-yl)propoxy]ethanol;trimethylsilylmethanol |
|---|---|
| PubChem CID | 173399866 |
| Molecular Formula | C12H32O4Si3 |
| Molecular Weight | 324.64 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-[3-(oxadisilinan-3-yl)propoxy]ethanol;trimethylsilylmethanol |
| SMILES | C[Si](C)(C)CO.OCCOCCC[SiH]1CCCO[SiH2]1 |
| InChI | InChI=1S/C8H20O3Si2.C4H12OSi/c9-3-6-10-4-1-7-13-8-2-5-11-12-13;1-6(2,3)4-5/h9,13H,1-8,12H2;5H,4H2,1-3H3 |
| InChIKey | NXCVOMWOVILALY-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.64 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|