C6H20O5Si3 — CID 174848492
2-butoxyethanol;1,3,5,2,4,6-trioxatrisilinane (PubChem CID 174848492) has the molecular formula C6H20O5Si3 and a molecular weight of 256.48 g/mol. Its IUPAC name is 2-butoxyethanol;1,3,5,2,4,6-trioxatrisilinane.
| Compound Name | 2-butoxyethanol;1,3,5,2,4,6-trioxatrisilinane |
|---|---|
| PubChem CID | 174848492 |
| Molecular Formula | C6H20O5Si3 |
| Molecular Weight | 256.48 g/mol |
| Exact Mass | 256.06 |
| IUPAC Name | 2-butoxyethanol;1,3,5,2,4,6-trioxatrisilinane |
| SMILES | CCCCOCCO.O1[SiH2]O[SiH2]O[SiH2]1 |
| InChI | InChI=1S/C6H14O2.H6O3Si3/c1-2-3-5-8-6-4-7;1-4-2-6-3-5-1/h7H,2-6H2,1H3;4-6H2 |
| InChIKey | WYCAARRGMAPIPU-UHFFFAOYSA-N |
| XLogP | -2.16 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.48 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|