C21H26NO2+ — CID 1734
(1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenylacetate (PubChem CID 1734) has the molecular formula C21H26NO2+ and a molecular weight of 324.44 g/mol. Its IUPAC name is (1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenylacetate.
| Compound Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenylacetate |
|---|---|
| PubChem CID | 1734 |
| Molecular Formula | C21H26NO2+ |
| Molecular Weight | 324.44 g/mol |
| Exact Mass | 324.20 |
| IUPAC Name | (1,1-dimethylpiperidin-1-ium-4-yl) 2,2-diphenylacetate |
| SMILES | C[N+]1(C)CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C21H26NO2/c1-22(2)15-13-19(14-16-22)24-21(23)20(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3/q+1 |
| InChIKey | HYJRTXSYDAFGJK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|