About sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate
sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate (PubChem CID 173402767) has the molecular formula C7H16NaO7P
and a molecular weight of 266.16 g/mol. Its IUPAC name is sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate.
Molecular Properties
| Compound Name | sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate |
| PubChem CID | 173402767 |
| Molecular Formula | C7H16NaO7P |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate |
| SMILES | CCCCC(O)(CO)C(=O)OP(=O)(O)O.[H-].[Na+] |
| InChI | InChI=1S/C7H15O7P.Na.H/c1-2-3-4-7(10,5-8)6(9)14-15(11,12)13;;/h8,10H,2-5H2,1H3,(H2,11,12,13);;/q;+1;-1 |
| InChIKey | NBRZQCWZSQUOIZ-UHFFFAOYSA-N |
| XLogP | -3.35 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | -3.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate?
The IUPAC name of sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate (CID 173402767) is sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate.
What is the SMILES notation for sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate?
The canonical SMILES for sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate is CCCCC(O)(CO)C(=O)OP(=O)(O)O.[H-].[Na+].
What is the InChIKey of sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate?
The InChIKey is NBRZQCWZSQUOIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15O7P.Na.H/c1-2-3-4-7(10,5-8)6(9)14-15(11,12)13;;/h8,10H,2-5H2,1H3,(H2,11,12,13);;/q;+1;-1.
What are the key properties of sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate?
sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate has a molecular weight of 266.16 g/mol, XLogP of -3.35, 6 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;phosphono 2-hydroxy-2-(hydroxymethyl)hexanoate is sourced from PubChem (CID 173402767), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).