C13H22N2O3Si — CID 173403456
prop-2-enyl 2-diazo-3-(dimethylsilyloxymethylidene)-4,4-dimethylpentanoate (PubChem CID 173403456) has the molecular formula C13H22N2O3Si and a molecular weight of 282.42 g/mol. Its IUPAC name is prop-2-enyl 2-diazo-3-(dimethylsilyloxymethylidene)-4,4-dimethylpentanoate.
| Compound Name | prop-2-enyl 2-diazo-3-(dimethylsilyloxymethylidene)-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 173403456 |
| Molecular Formula | C13H22N2O3Si |
| Molecular Weight | 282.42 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | prop-2-enyl 2-diazo-3-(dimethylsilyloxymethylidene)-4,4-dimethylpentanoate |
| SMILES | C=CCOC(=O)C(=[N+]=[N-])C(=CO[SiH](C)C)C(C)(C)C |
| InChI | InChI=1S/C13H22N2O3Si/c1-7-8-17-12(16)11(15-14)10(13(2,3)4)9-18-19(5)6/h7,9,19H,1,8H2,2-6H3 |
| InChIKey | AFVKEQLQUJUTPE-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 71.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|