C20H32NO5Si+ — CID 173404436
1-O-benzyl 2-O-methyl (2S,4R)-4-tert-butyl-2,3-dimethyl-1-silyloxypyrrolidin-1-ium-1,2-dicarboxylate (PubChem CID 173404436) has the molecular formula C20H32NO5Si+ and a molecular weight of 394.56 g/mol. Its IUPAC name is 1-O-benzyl 2-O-methyl (2S,4R)-4-tert-butyl-2,3-dimethyl-1-silyloxypyrrolidin-1-ium-1,2-dicarboxylate.
| Compound Name | 1-O-benzyl 2-O-methyl (2S,4R)-4-tert-butyl-2,3-dimethyl-1-silyloxypyrrolidin-1-ium-1,2-dicarboxylate |
|---|---|
| PubChem CID | 173404436 |
| Molecular Formula | C20H32NO5Si+ |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 1-O-benzyl 2-O-methyl (2S,4R)-4-tert-butyl-2,3-dimethyl-1-silyloxypyrrolidin-1-ium-1,2-dicarboxylate |
| SMILES | COC(=O)[C@]1(C)C(C)[C@H](C(C)(C)C)C[N+]1(O[SiH3])C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H32NO5Si/c1-14-16(19(2,3)4)12-21(26-27,20(14,5)17(22)24-6)18(23)25-13-15-10-8-7-9-11-15/h7-11,14,16H,12-13H2,1-6,27H3/q+1/t14?,16-,20+,21?/m1/s1 |
| InChIKey | OSCYUIRWBKEENH-XKBZUYKCSA-N |
| XLogP | 2.60 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|