C21H20NO7+ — CID 89487100
(2S)-4-oxo-1,1-bis(phenylmethoxycarbonyl)pyrrolidin-1-ium-2-carboxylic acid (PubChem CID 89487100) has the molecular formula C21H20NO7+ and a molecular weight of 398.39 g/mol. Its IUPAC name is (2S)-4-oxo-1,1-bis(phenylmethoxycarbonyl)pyrrolidin-1-ium-2-carboxylic acid.
| Compound Name | (2S)-4-oxo-1,1-bis(phenylmethoxycarbonyl)pyrrolidin-1-ium-2-carboxylic acid |
|---|---|
| PubChem CID | 89487100 |
| Molecular Formula | C21H20NO7+ |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | (2S)-4-oxo-1,1-bis(phenylmethoxycarbonyl)pyrrolidin-1-ium-2-carboxylic acid |
| SMILES | O=C1C[C@@H](C(=O)O)[N+](C(=O)OCc2ccccc2)(C(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C21H19NO7/c23-17-11-18(19(24)25)22(12-17,20(26)28-13-15-7-3-1-4-8-15)21(27)29-14-16-9-5-2-6-10-16/h1-10,18H,11-14H2/p+1/t18-/m0/s1 |
| InChIKey | AKAYCLLCHNDSRG-SFHVURJKSA-O |
| XLogP | 2.90 |
| TPSA | 106.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|