About CID 173410069
CID 173410069 (PubChem CID 173410069) has the molecular formula C15H18NaO3S
and a molecular weight of 301.36 g/mol.
Molecular Properties
| Compound Name | CID 173410069 |
| PubChem CID | 173410069 |
| Molecular Formula | C15H18NaO3S |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | — |
| SMILES | CCC(CC)OS(=O)(=O)c1ccc2cccccc1-2.[Na] |
| InChI | InChI=1S/C15H18O3S.Na/c1-3-13(4-2)18-19(16,17)15-11-10-12-8-6-5-7-9-14(12)15;/h5-11,13H,3-4H2,1-2H3; |
| InChIKey | JXLNZTZFFSSXDI-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze CID 173410069 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173410069?
The IUPAC name of CID 173410069 (CID 173410069) is not available.
What is the SMILES notation for CID 173410069?
The canonical SMILES for CID 173410069 is CCC(CC)OS(=O)(=O)c1ccc2cccccc1-2.[Na].
What is the InChIKey of CID 173410069?
The InChIKey is JXLNZTZFFSSXDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18O3S.Na/c1-3-13(4-2)18-19(16,17)15-11-10-12-8-6-5-7-9-14(12)15;/h5-11,13H,3-4H2,1-2H3;.
What are the key properties of CID 173410069?
CID 173410069 has a molecular weight of 301.36 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173410069 is sourced from PubChem (CID 173410069), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).