C23H31KO3 — CID 173418007
potassium;3-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-16-methylidene-3-oxo-2,8,9,11,12,14,15,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid;hydride (PubChem CID 173418007) has the molecular formula C23H31KO3 and a molecular weight of 394.60 g/mol. Its IUPAC name is potassium;3-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-16-methylidene-3-oxo-2,8,9,11,12,14,15,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid;hydride.
| Compound Name | potassium;3-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-16-methylidene-3-oxo-2,8,9,11,12,14,15,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid;hydride |
|---|---|
| PubChem CID | 173418007 |
| Molecular Formula | C23H31KO3 |
| Molecular Weight | 394.60 g/mol |
| Exact Mass | 394.19 |
| IUPAC Name | potassium;3-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-16-methylidene-3-oxo-2,8,9,11,12,14,15,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoic acid;hydride |
| SMILES | C=C1C[C@H]2[C@@H]3C=CC4=CC(=O)CC[C@]4(C)[C@H]3CC[C@]2(C)[C@H]1CCC(=O)O.[H-].[K+] |
| InChI | InChI=1S/C23H30O3.K.H/c1-14-12-20-17-5-4-15-13-16(24)8-10-22(15,2)19(17)9-11-23(20,3)18(14)6-7-21(25)26;;/h4-5,13,17-20H,1,6-12H2,2-3H3,(H,25,26);;/q;+1;-1/t17-,18+,19+,20+,22+,23-;;/m1../s1 |
| InChIKey | RWGYACXDLVARQY-MCZYRPASSA-N |
| XLogP | 2.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.60 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|