C24H31FO2 — CID 173420073
3-ethyl-4-[2-ethyl-1-fluoro-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoic acid (PubChem CID 173420073) has the molecular formula C24H31FO2 and a molecular weight of 370.51 g/mol. Its IUPAC name is 3-ethyl-4-[2-ethyl-1-fluoro-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoic acid.
| Compound Name | 3-ethyl-4-[2-ethyl-1-fluoro-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoic acid |
|---|---|
| PubChem CID | 173420073 |
| Molecular Formula | C24H31FO2 |
| Molecular Weight | 370.51 g/mol |
| Exact Mass | 370.23 |
| IUPAC Name | 3-ethyl-4-[2-ethyl-1-fluoro-3-(2,6,6-trimethylcyclohexen-1-yl)buta-1,3-dienyl]benzoic acid |
| SMILES | C=C(C(CC)=C(F)c1ccc(C(=O)O)cc1CC)C1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C24H31FO2/c1-7-17-14-18(23(26)27)11-12-20(17)22(25)19(8-2)16(4)21-15(3)10-9-13-24(21,5)6/h11-12,14H,4,7-10,13H2,1-3,5-6H3,(H,26,27) |
| InChIKey | ZANVHEJCPZGENG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.51 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|