About CID 173421709
CID 173421709 (PubChem CID 173421709) has the molecular formula C10H18AlO2
and a molecular weight of 197.23 g/mol.
Molecular Properties
| Compound Name | CID 173421709 |
| PubChem CID | 173421709 |
| Molecular Formula | C10H18AlO2 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)[Al]C(=O)C(C)(C)C |
| InChI | InChI=1S/2C5H9O.Al/c2*1-5(2,3)4-6;/h2*1-3H3; |
| InChIKey | QOHZPAZGOJBZLX-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 173421709 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173421709?
The IUPAC name of CID 173421709 (CID 173421709) is not available.
What is the SMILES notation for CID 173421709?
The canonical SMILES for CID 173421709 is CC(C)(C)C(=O)[Al]C(=O)C(C)(C)C.
What is the InChIKey of CID 173421709?
The InChIKey is QOHZPAZGOJBZLX-UHFFFAOYSA-N. The full InChI is InChI=1S/2C5H9O.Al/c2*1-5(2,3)4-6;/h2*1-3H3;.
What are the key properties of CID 173421709?
CID 173421709 has a molecular weight of 197.23 g/mol, XLogP of 1.84, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173421709 is sourced from PubChem (CID 173421709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).