About azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid
azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid (PubChem CID 173423435) has the molecular formula C18H34N2O7S
and a molecular weight of 422.54 g/mol. Its IUPAC name is azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid.
Molecular Properties
| Compound Name | azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid |
| PubChem CID | 173423435 |
| Molecular Formula | C18H34N2O7S |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.21 |
| IUPAC Name | azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid |
| SMILES | C1CCC(C2CCCCC2)CC1.CO/N=C(\C(=O)O)C(=O)COS(C)(=O)=O.N |
| InChI | InChI=1S/C12H22.C6H9NO7S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-13-7-5(6(9)10)4(8)3-14-15(2,11)12;/h11-12H,1-10H2;3H2,1-2H3,(H,9,10);1H3/b;7-5-; |
| InChIKey | MVRFIVKWSMLMIE-IQGCDTTGSA-N |
| XLogP | 2.93 |
| TPSA | 154.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid?
The IUPAC name of azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid (CID 173423435) is azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid.
What is the SMILES notation for azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid?
The canonical SMILES for azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid is C1CCC(C2CCCCC2)CC1.CO/N=C(\C(=O)O)C(=O)COS(C)(=O)=O.N.
What is the InChIKey of azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid?
The InChIKey is MVRFIVKWSMLMIE-IQGCDTTGSA-N. The full InChI is InChI=1S/C12H22.C6H9NO7S.H3N/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-13-7-5(6(9)10)4(8)3-14-15(2,11)12;/h11-12H,1-10H2;3H2,1-2H3,(H,9,10);1H3/b;7-5-;.
What are the key properties of azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid?
azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid has a molecular weight of 422.54 g/mol, XLogP of 2.93, 7 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for azane;cyclohexylcyclohexane;(2Z)-2-methoxyimino-4-methylsulfonyloxy-3-oxobutanoic acid is sourced from PubChem (CID 173423435), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).